C22H15N7O2 — CID 168571993
6-oxo-4-phenyl-2-[2-[(3-pyrazin-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168571993) has the molecular formula C22H15N7O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 6-oxo-4-phenyl-2-[2-[(3-pyrazin-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-4-phenyl-2-[2-[(3-pyrazin-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571993 |
| Molecular Formula | C22H15N7O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 6-oxo-4-phenyl-2-[2-[(3-pyrazin-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cccc(Oc3cnccn3)c2)[nH]c1=O |
| InChI | InChI=1S/C22H15N7O2/c23-12-18-20(16-6-2-1-3-7-16)27-22(28-21(18)30)29-26-13-15-5-4-8-17(11-15)31-19-14-24-9-10-25-19/h1-11,13-14H,(H2,27,28,29,30) |
| InChIKey | IZZVIGIXGWQJFA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|