C25H17Cl2N5O2 — CID 168573297
2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168573297) has the molecular formula C25H17Cl2N5O2 and a molecular weight of 490.35 g/mol. Its IUPAC name is 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168573297 |
| Molecular Formula | C25H17Cl2N5O2 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cccc(OCc3ccc(Cl)c(Cl)c3)c2)[nH]c1=O |
| InChI | InChI=1S/C25H17Cl2N5O2/c26-21-10-9-17(12-22(21)27)15-34-19-8-4-5-16(11-19)14-29-32-25-30-23(18-6-2-1-3-7-18)20(13-28)24(33)31-25/h1-12,14H,15H2,(H2,30,31,32,33) |
| InChIKey | LVCARCNBVFAPCO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|