C28H23N5O5 — CID 168571921
methyl 4-[2-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate (PubChem CID 168571921) has the molecular formula C28H23N5O5 and a molecular weight of 509.52 g/mol. Its IUPAC name is methyl 4-[2-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 168571921 |
| Molecular Formula | C28H23N5O5 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | methyl 4-[2-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOc2cccc(C=NNc3nc(-c4ccccc4)c(C#N)c(=O)[nH]3)c2)cc1 |
| InChI | InChI=1S/C28H23N5O5/c1-36-27(35)21-10-12-22(13-11-21)37-14-15-38-23-9-5-6-19(16-23)18-30-33-28-31-25(20-7-3-2-4-8-20)24(17-29)26(34)32-28/h2-13,16,18H,14-15H2,1H3,(H2,31,32,33,34) |
| InChIKey | MFXXXYRFBQRIAF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|