C25H16ClN5O3 — CID 168572904
[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 168572904) has the molecular formula C25H16ClN5O3 and a molecular weight of 469.89 g/mol. Its IUPAC name is [3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 168572904 |
| Molecular Formula | C25H16ClN5O3 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | [3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cccc(OC(=O)c3ccc(Cl)cc3)c2)[nH]c1=O |
| InChI | InChI=1S/C25H16ClN5O3/c26-19-11-9-18(10-12-19)24(33)34-20-8-4-5-16(13-20)15-28-31-25-29-22(17-6-2-1-3-7-17)21(14-27)23(32)30-25/h1-13,15H,(H2,29,30,31,32) |
| InChIKey | JZNWZHGGSMDGET-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|