C25H25N5O4 — CID 168572676
ethyl 5-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]pentanoate (PubChem CID 168572676) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is ethyl 5-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]pentanoate.
| Compound Name | ethyl 5-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 168572676 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | ethyl 5-[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1cccc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C25H25N5O4/c1-2-33-22(31)13-6-7-14-34-20-12-8-9-18(15-20)17-27-30-25-28-23(19-10-4-3-5-11-19)21(16-26)24(32)29-25/h3-5,8-12,15,17H,2,6-7,13-14H2,1H3,(H2,28,29,30,32) |
| InChIKey | WGGJPCGKWUAVFD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|