C27H21Cl2N5O3 — CID 168572872
2-[2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572872) has the molecular formula C27H21Cl2N5O3 and a molecular weight of 534.40 g/mol. Its IUPAC name is 2-[2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572872 |
| Molecular Formula | C27H21Cl2N5O3 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 2-[2-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CCOc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H21Cl2N5O3/c1-2-36-24-13-17(9-11-23(24)37-16-18-8-10-21(28)22(29)12-18)15-31-34-27-32-25(19-6-4-3-5-7-19)20(14-30)26(35)33-27/h3-13,15H,2,16H2,1H3,(H2,32,33,34,35) |
| InChIKey | WFCAHWKWWDVTRM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|