C19H10BrF3N6O4 — CID 168571653
2-[2-[[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571653) has the molecular formula C19H10BrF3N6O4 and a molecular weight of 523.23 g/mol. Its IUPAC name is 2-[2-[[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571653 |
| Molecular Formula | C19H10BrF3N6O4 |
| Molecular Weight | 523.23 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | 2-[2-[[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cc(Br)c(OC(F)(F)F)c([N+](=O)[O-])c2)[nH]c1=O |
| InChI | InChI=1S/C19H10BrF3N6O4/c20-13-6-10(7-14(29(31)32)16(13)33-19(21,22)23)9-25-28-18-26-15(11-4-2-1-3-5-11)12(8-24)17(30)27-18/h1-7,9H,(H2,26,27,28,30) |
| InChIKey | AFNMWLLBARBEQW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|