C20H16FN5O — CID 168573097
2-[2-[(4-fluoro-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168573097) has the molecular formula C20H16FN5O and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-[2-[(4-fluoro-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(4-fluoro-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168573097 |
| Molecular Formula | C20H16FN5O |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[2-[(4-fluoro-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc(C)c1F |
| InChI | InChI=1S/C20H16FN5O/c1-12-8-14(9-13(2)17(12)21)11-23-26-20-24-18(15-6-4-3-5-7-15)16(10-22)19(27)25-20/h3-9,11H,1-2H3,(H2,24,25,26,27) |
| InChIKey | WIZFQOXTKCIBOC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|