C18H10Cl2FN5O — CID 168571550
2-[2-[(3,6-dichloro-2-fluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571550) has the molecular formula C18H10Cl2FN5O and a molecular weight of 402.22 g/mol. Its IUPAC name is 2-[2-[(3,6-dichloro-2-fluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(3,6-dichloro-2-fluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571550 |
| Molecular Formula | C18H10Cl2FN5O |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[2-[(3,6-dichloro-2-fluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2c(Cl)ccc(Cl)c2F)[nH]c1=O |
| InChI | InChI=1S/C18H10Cl2FN5O/c19-13-6-7-14(20)15(21)12(13)9-23-26-18-24-16(10-4-2-1-3-5-10)11(8-22)17(27)25-18/h1-7,9H,(H2,24,25,26,27) |
| InChIKey | GVTFQCFBHILMQX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|