C19H10F2N6O — CID 168572734
2-[2-[(3-cyano-2,6-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572734) has the molecular formula C19H10F2N6O and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-[2-[(3-cyano-2,6-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(3-cyano-2,6-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572734 |
| Molecular Formula | C19H10F2N6O |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[2-[(3-cyano-2,6-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1ccc(F)c(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1F |
| InChI | InChI=1S/C19H10F2N6O/c20-15-7-6-12(8-22)16(21)14(15)10-24-27-19-25-17(11-4-2-1-3-5-11)13(9-23)18(28)26-19/h1-7,10H,(H2,25,26,27,28) |
| InChIKey | MWSWOJMNNVVGID-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|