C18H11FIN5O — CID 168572858
2-[2-[(2-fluoro-5-iodophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572858) has the molecular formula C18H11FIN5O and a molecular weight of 459.22 g/mol. Its IUPAC name is 2-[2-[(2-fluoro-5-iodophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(2-fluoro-5-iodophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572858 |
| Molecular Formula | C18H11FIN5O |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 2-[2-[(2-fluoro-5-iodophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cc(I)ccc2F)[nH]c1=O |
| InChI | InChI=1S/C18H11FIN5O/c19-15-7-6-13(20)8-12(15)10-22-25-18-23-16(11-4-2-1-3-5-11)14(9-21)17(26)24-18/h1-8,10H,(H2,23,24,25,26) |
| InChIKey | HAQWTKQPJDXQRA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|