C20H13FN6O — CID 168571865
2-[2-[(4-fluoro-1H-indol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571865) has the molecular formula C20H13FN6O and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-[2-[(4-fluoro-1H-indol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(4-fluoro-1H-indol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571865 |
| Molecular Formula | C20H13FN6O |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[2-[(4-fluoro-1H-indol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(F)c3cc[nH]c23)[nH]c1=O |
| InChI | InChI=1S/C20H13FN6O/c21-16-7-6-13(17-14(16)8-9-23-17)11-24-27-20-25-18(12-4-2-1-3-5-12)15(10-22)19(28)26-20/h1-9,11,23H,(H2,25,26,27,28) |
| InChIKey | PBGOIBYPURCTFL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|