C20H15F2N5O2 — CID 168571506
2-[2-[(3-ethoxy-2,4-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571506) has the molecular formula C20H15F2N5O2 and a molecular weight of 395.37 g/mol. Its IUPAC name is 2-[2-[(3-ethoxy-2,4-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(3-ethoxy-2,4-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571506 |
| Molecular Formula | C20H15F2N5O2 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[2-[(3-ethoxy-2,4-difluorophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CCOc1c(F)ccc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1F |
| InChI | InChI=1S/C20H15F2N5O2/c1-2-29-18-15(21)9-8-13(16(18)22)11-24-27-20-25-17(12-6-4-3-5-7-12)14(10-23)19(28)26-20/h3-9,11H,2H2,1H3,(H2,25,26,27,28) |
| InChIKey | FLOMQXNQKSDZEO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|