C24H26N6O2 — CID 168573559
2-[2-[[4-(diethylamino)-2-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168573559) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[2-[[4-(diethylamino)-2-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(diethylamino)-2-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168573559 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[2-[[4-(diethylamino)-2-ethoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CCOc1cc(N(CC)CC)ccc1C=NNc1nc(-c2ccccc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C24H26N6O2/c1-4-30(5-2)19-13-12-18(21(14-19)32-6-3)16-26-29-24-27-22(17-10-8-7-9-11-17)20(15-25)23(31)28-24/h7-14,16H,4-6H2,1-3H3,(H2,27,28,29,31) |
| InChIKey | CUJGQKCEWXNKRY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|