C23H18BrN5O3 — CID 168572498
2-[2-[(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572498) has the molecular formula C23H18BrN5O3 and a molecular weight of 492.33 g/mol. Its IUPAC name is 2-[2-[(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572498 |
| Molecular Formula | C23H18BrN5O3 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[2-[(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | C#CCOc1cc(Br)c(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc1OCC |
| InChI | InChI=1S/C23H18BrN5O3/c1-3-10-32-20-12-18(24)16(11-19(20)31-4-2)14-26-29-23-27-21(15-8-6-5-7-9-15)17(13-25)22(30)28-23/h1,5-9,11-12,14H,4,10H2,2H3,(H2,27,28,29,30) |
| InChIKey | VJZBPSXYOVQVND-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|