C27H22BrN5O3 — CID 168572588
2-[2-[[2-bromo-5-methoxy-4-(2-phenylethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572588) has the molecular formula C27H22BrN5O3 and a molecular weight of 544.41 g/mol. Its IUPAC name is 2-[2-[[2-bromo-5-methoxy-4-(2-phenylethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-bromo-5-methoxy-4-(2-phenylethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572588 |
| Molecular Formula | C27H22BrN5O3 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | 2-[2-[[2-bromo-5-methoxy-4-(2-phenylethoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c(Br)cc1OCCc1ccccc1 |
| InChI | InChI=1S/C27H22BrN5O3/c1-35-23-14-20(22(28)15-24(23)36-13-12-18-8-4-2-5-9-18)17-30-33-27-31-25(19-10-6-3-7-11-19)21(16-29)26(34)32-27/h2-11,14-15,17H,12-13H2,1H3,(H2,31,32,33,34) |
| InChIKey | IWYKAPWTWIJMQO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|