C26H18Cl3N5O3 — CID 168572493
2-[2-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572493) has the molecular formula C26H18Cl3N5O3 and a molecular weight of 554.82 g/mol. Its IUPAC name is 2-[2-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572493 |
| Molecular Formula | C26H18Cl3N5O3 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 553.05 |
| IUPAC Name | 2-[2-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c(Cl)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H18Cl3N5O3/c1-36-22-9-17(21(29)11-23(22)37-14-16-7-8-18(27)10-20(16)28)13-31-34-26-32-24(15-5-3-2-4-6-15)19(12-30)25(35)33-26/h2-11,13H,14H2,1H3,(H2,32,33,34,35) |
| InChIKey | FFNDWPUSLVKZFM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|