C30H27ClN6O4 — CID 168572489
2-[5-chloro-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 168572489) has the molecular formula C30H27ClN6O4 and a molecular weight of 571.04 g/mol. Its IUPAC name is 2-[5-chloro-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[5-chloro-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 168572489 |
| Molecular Formula | C30H27ClN6O4 |
| Molecular Weight | 571.04 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 2-[5-chloro-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | CCOc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c(Cl)cc1OCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C30H27ClN6O4/c1-2-40-25-15-22(24(31)16-26(25)41-19-27(38)33-14-13-20-9-5-3-6-10-20)18-34-37-30-35-28(21-11-7-4-8-12-21)23(17-32)29(39)36-30/h3-12,15-16,18H,2,13-14,19H2,1H3,(H,33,38)(H2,35,36,37,39) |
| InChIKey | FFXLIXIAQKRLAI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.04 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|