C21H16BrN5O4 — CID 168571941
[5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 168571941) has the molecular formula C21H16BrN5O4 and a molecular weight of 482.29 g/mol. Its IUPAC name is [5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 168571941 |
| Molecular Formula | C21H16BrN5O4 |
| Molecular Weight | 482.29 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | [5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C21H16BrN5O4/c1-12(28)31-18-9-16(22)14(8-17(18)30-2)11-24-27-21-25-19(13-6-4-3-5-7-13)15(10-23)20(29)26-21/h3-9,11H,1-2H3,(H2,25,26,27,29) |
| InChIKey | INUNLUQFNRTVIB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|