C21H17N5O5 — CID 168572775
[3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-4-methoxyphenyl] methyl carbonate (PubChem CID 168572775) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is [3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-4-methoxyphenyl] methyl carbonate.
| Compound Name | [3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-4-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 168572775 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [3-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-4-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(OC)c(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C21H17N5O5/c1-29-17-9-8-15(31-21(28)30-2)10-14(17)12-23-26-20-24-18(13-6-4-3-5-7-13)16(11-22)19(27)25-20/h3-10,12H,1-2H3,(H2,24,25,26,27) |
| InChIKey | VLEHJBVSRODPLC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|