C27H23N5O4S — CID 168571641
2-[2-[[2-(2,5-dimethoxyphenyl)sulfanyl-6-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571641) has the molecular formula C27H23N5O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is 2-[2-[[2-(2,5-dimethoxyphenyl)sulfanyl-6-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-(2,5-dimethoxyphenyl)sulfanyl-6-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571641 |
| Molecular Formula | C27H23N5O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-[2-[[2-(2,5-dimethoxyphenyl)sulfanyl-6-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(OC)c(Sc2cccc(OC)c2C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C27H23N5O4S/c1-34-18-12-13-22(36-3)24(14-18)37-23-11-7-10-21(35-2)20(23)16-29-32-27-30-25(17-8-5-4-6-9-17)19(15-28)26(33)31-27/h4-14,16H,1-3H3,(H2,30,31,32,33) |
| InChIKey | DYDXSYCRFRXPNK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|