C26H21N5O2 — CID 168572252
2-[2-[[2-(3,4-dimethylphenoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572252) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-[2-[[2-(3,4-dimethylphenoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-(3,4-dimethylphenoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572252 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[2-[[2-(3,4-dimethylphenoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(Oc2ccccc2C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C26H21N5O2/c1-17-12-13-21(14-18(17)2)33-23-11-7-6-10-20(23)16-28-31-26-29-24(19-8-4-3-5-9-19)22(15-27)25(32)30-26/h3-14,16H,1-2H3,(H2,29,30,31,32) |
| InChIKey | UBZMSZVKHVQSBE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|