C22H16N6O — CID 168573505
2-[2-[(8-methylquinolin-5-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168573505) has the molecular formula C22H16N6O and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-[2-[(8-methylquinolin-5-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(8-methylquinolin-5-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168573505 |
| Molecular Formula | C22H16N6O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[2-[(8-methylquinolin-5-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c2cccnc12 |
| InChI | InChI=1S/C22H16N6O/c1-14-9-10-16(17-8-5-11-24-19(14)17)13-25-28-22-26-20(15-6-3-2-4-7-15)18(12-23)21(29)27-22/h2-11,13H,1H3,(H2,26,27,28,29) |
| InChIKey | SHYKSCGCGJMFIC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|