C20H14N6O — CID 168572558
2-[2-(1H-indol-4-ylmethylidene)hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572558) has the molecular formula C20H14N6O and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-[2-(1H-indol-4-ylmethylidene)hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-(1H-indol-4-ylmethylidene)hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572558 |
| Molecular Formula | C20H14N6O |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[2-(1H-indol-4-ylmethylidene)hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cccc3[nH]ccc23)[nH]c1=O |
| InChI | InChI=1S/C20H14N6O/c21-11-16-18(13-5-2-1-3-6-13)24-20(25-19(16)27)26-23-12-14-7-4-8-17-15(14)9-10-22-17/h1-10,12,22H,(H2,24,25,26,27) |
| InChIKey | UNWJGOSOMIUWTH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|