C20H15N7O — CID 168572315
2-[2-[(2-methylindazol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572315) has the molecular formula C20H15N7O and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-[2-[(2-methylindazol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(2-methylindazol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572315 |
| Molecular Formula | C20H15N7O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[2-[(2-methylindazol-7-yl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | Cn1cc2cccc(C=NNc3nc(-c4ccccc4)c(C#N)c(=O)[nH]3)c2n1 |
| InChI | InChI=1S/C20H15N7O/c1-27-12-15-9-5-8-14(17(15)26-27)11-22-25-20-23-18(13-6-3-2-4-7-13)16(10-21)19(28)24-20/h2-9,11-12H,1H3,(H2,23,24,25,28) |
| InChIKey | MKRSHVFFLJGCAI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|