C24H21N7O2 — CID 168572982
2-[2-[[2-(3-imidazol-1-ylpropoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572982) has the molecular formula C24H21N7O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-[2-[[2-(3-imidazol-1-ylpropoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-(3-imidazol-1-ylpropoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572982 |
| Molecular Formula | C24H21N7O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[2-[[2-(3-imidazol-1-ylpropoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccccc2OCCCn2ccnc2)[nH]c1=O |
| InChI | InChI=1S/C24H21N7O2/c25-15-20-22(18-7-2-1-3-8-18)28-24(29-23(20)32)30-27-16-19-9-4-5-10-21(19)33-14-6-12-31-13-11-26-17-31/h1-5,7-11,13,16-17H,6,12,14H2,(H2,28,29,30,32) |
| InChIKey | SCJCXUHAOQHVSI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|