C25H16F3N5O — CID 168570931
6-oxo-4-phenyl-2-[2-[[2-[3-(trifluoromethyl)phenyl]phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168570931) has the molecular formula C25H16F3N5O and a molecular weight of 459.43 g/mol. Its IUPAC name is 6-oxo-4-phenyl-2-[2-[[2-[3-(trifluoromethyl)phenyl]phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-4-phenyl-2-[2-[[2-[3-(trifluoromethyl)phenyl]phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168570931 |
| Molecular Formula | C25H16F3N5O |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 6-oxo-4-phenyl-2-[2-[[2-[3-(trifluoromethyl)phenyl]phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccccc2-c2cccc(C(F)(F)F)c2)[nH]c1=O |
| InChI | InChI=1S/C25H16F3N5O/c26-25(27,28)19-11-6-10-17(13-19)20-12-5-4-9-18(20)15-30-33-24-31-22(16-7-2-1-3-8-16)21(14-29)23(34)32-24/h1-13,15H,(H2,31,32,33,34) |
| InChIKey | WWRWNEPMASZOQC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|