C19H13BF3N5O3 — CID 168573454
[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-3-(trifluoromethyl)phenyl]boronic acid (PubChem CID 168573454) has the molecular formula C19H13BF3N5O3 and a molecular weight of 427.15 g/mol. Its IUPAC name is [4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-3-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | [4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-3-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 168573454 |
| Molecular Formula | C19H13BF3N5O3 |
| Molecular Weight | 427.15 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-3-(trifluoromethyl)phenyl]boronic acid |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(B(O)O)cc2C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C19H13BF3N5O3/c21-19(22,23)15-8-13(20(30)31)7-6-12(15)10-25-28-18-26-16(11-4-2-1-3-5-11)14(9-24)17(29)27-18/h1-8,10,30-31H,(H2,26,27,28,29) |
| InChIKey | URMVPJMKRKNVKT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|