C19H10ClF4N5O — CID 168571542
2-[2-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571542) has the molecular formula C19H10ClF4N5O and a molecular weight of 435.77 g/mol. Its IUPAC name is 2-[2-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571542 |
| Molecular Formula | C19H10ClF4N5O |
| Molecular Weight | 435.77 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-[2-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2c(C(F)(F)F)ccc(Cl)c2F)[nH]c1=O |
| InChI | InChI=1S/C19H10ClF4N5O/c20-14-7-6-13(19(22,23)24)12(15(14)21)9-26-29-18-27-16(10-4-2-1-3-5-10)11(8-25)17(30)28-18/h1-7,9H,(H2,27,28,29,30) |
| InChIKey | PPTBOYMFHRIXLV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|