C19H13BrIN5O2 — CID 168572531
2-[2-[(5-bromo-3-iodo-2-methoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572531) has the molecular formula C19H13BrIN5O2 and a molecular weight of 550.15 g/mol. Its IUPAC name is 2-[2-[(5-bromo-3-iodo-2-methoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(5-bromo-3-iodo-2-methoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572531 |
| Molecular Formula | C19H13BrIN5O2 |
| Molecular Weight | 550.15 g/mol |
| Exact Mass | 548.93 |
| IUPAC Name | 2-[2-[(5-bromo-3-iodo-2-methoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1c(I)cc(Br)cc1C=NNc1nc(-c2ccccc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H13BrIN5O2/c1-28-17-12(7-13(20)8-15(17)21)10-23-26-19-24-16(11-5-3-2-4-6-11)14(9-22)18(27)25-19/h2-8,10H,1H3,(H2,24,25,26,27) |
| InChIKey | YWIGFGFSWFKSLX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|