C19H12IN5O3 — CID 168570842
2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-5-iodobenzoic acid (PubChem CID 168570842) has the molecular formula C19H12IN5O3 and a molecular weight of 485.24 g/mol. Its IUPAC name is 2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-5-iodobenzoic acid.
| Compound Name | 2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 168570842 |
| Molecular Formula | C19H12IN5O3 |
| Molecular Weight | 485.24 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-5-iodobenzoic acid |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(I)cc2C(=O)O)[nH]c1=O |
| InChI | InChI=1S/C19H12IN5O3/c20-13-7-6-12(14(8-13)18(27)28)10-22-25-19-23-16(11-4-2-1-3-5-11)15(9-21)17(26)24-19/h1-8,10H,(H,27,28)(H2,23,24,25,26) |
| InChIKey | ZQZUOIIUORGULP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|