C19H13BrFN5O — CID 168571762
2-[2-[[2-(bromomethyl)-6-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571762) has the molecular formula C19H13BrFN5O and a molecular weight of 426.25 g/mol. Its IUPAC name is 2-[2-[[2-(bromomethyl)-6-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-(bromomethyl)-6-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571762 |
| Molecular Formula | C19H13BrFN5O |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 2-[2-[[2-(bromomethyl)-6-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2c(F)cccc2CBr)[nH]c1=O |
| InChI | InChI=1S/C19H13BrFN5O/c20-9-13-7-4-8-16(21)15(13)11-23-26-19-24-17(12-5-2-1-3-6-12)14(10-22)18(27)25-19/h1-8,11H,9H2,(H2,24,25,26,27) |
| InChIKey | NDWKDBPDQZNOCC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|