C19H13BrN6O4 — CID 168570876
2-[2-[(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168570876) has the molecular formula C19H13BrN6O4 and a molecular weight of 469.26 g/mol. Its IUPAC name is 2-[2-[(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168570876 |
| Molecular Formula | C19H13BrN6O4 |
| Molecular Weight | 469.26 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 2-[2-[(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1c([N+](=O)[O-])cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c(O)c1Br |
| InChI | InChI=1S/C19H13BrN6O4/c1-10-14(26(29)30)7-12(17(27)15(10)20)9-22-25-19-23-16(11-5-3-2-4-6-11)13(8-21)18(28)24-19/h2-7,9,27H,1H3,(H2,23,24,25,28) |
| InChIKey | QCGHIYJEPNHHDB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|