C19H13ClN6O4 — CID 168571635
2-[2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571635) has the molecular formula C19H13ClN6O4 and a molecular weight of 424.80 g/mol. Its IUPAC name is 2-[2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571635 |
| Molecular Formula | C19H13ClN6O4 |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-[2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cc([N+](=O)[O-])cc(CCl)c2O)[nH]c1=O |
| InChI | InChI=1S/C19H13ClN6O4/c20-8-12-6-14(26(29)30)7-13(17(12)27)10-22-25-19-23-16(11-4-2-1-3-5-11)15(9-21)18(28)24-19/h1-7,10,27H,8H2,(H2,23,24,25,28) |
| InChIKey | AYLSBSHJBNHESX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|