C19H14N6O5 — CID 168571502
2-[2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571502) has the molecular formula C19H14N6O5 and a molecular weight of 406.36 g/mol. Its IUPAC name is 2-[2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571502 |
| Molecular Formula | C19H14N6O5 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-[2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H14N6O5/c1-30-15-8-11(7-14(17(15)26)25(28)29)10-21-24-19-22-16(12-5-3-2-4-6-12)13(9-20)18(27)23-19/h2-8,10,26H,1H3,(H2,22,23,24,27) |
| InChIKey | YPPTZYOLFQIDHM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|