C25H15F3N6O4 — CID 168571419
2-[2-[[3-nitro-4-[3-(trifluoromethyl)phenoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571419) has the molecular formula C25H15F3N6O4 and a molecular weight of 520.43 g/mol. Its IUPAC name is 2-[2-[[3-nitro-4-[3-(trifluoromethyl)phenoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[3-nitro-4-[3-(trifluoromethyl)phenoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571419 |
| Molecular Formula | C25H15F3N6O4 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[2-[[3-nitro-4-[3-(trifluoromethyl)phenoxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(Oc3cccc(C(F)(F)F)c3)c([N+](=O)[O-])c2)[nH]c1=O |
| InChI | InChI=1S/C25H15F3N6O4/c26-25(27,28)17-7-4-8-18(12-17)38-21-10-9-15(11-20(21)34(36)37)14-30-33-24-31-22(16-5-2-1-3-6-16)19(13-29)23(35)32-24/h1-12,14H,(H2,31,32,33,35) |
| InChIKey | ZSZYWDQPLWZRRD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|