C25H27N5O2 — CID 168571268
2-[2-[[4-(hexoxymethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571268) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[2-[[4-(hexoxymethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(hexoxymethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571268 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[2-[[4-(hexoxymethyl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CCCCCCOCc1ccc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H27N5O2/c1-2-3-4-8-15-32-18-20-13-11-19(12-14-20)17-27-30-25-28-23(21-9-6-5-7-10-21)22(16-26)24(31)29-25/h5-7,9-14,17H,2-4,8,15,18H2,1H3,(H2,28,29,30,31) |
| InChIKey | PWVSKQCEEFZTAS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|