C24H23N5O5 — CID 168572688
2-[2-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572688) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is 2-[2-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572688 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[2-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cccc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c1OCCC1OCCO1 |
| InChI | InChI=1S/C24H23N5O5/c1-31-19-9-5-8-17(22(19)34-11-10-20-32-12-13-33-20)15-26-29-24-27-21(16-6-3-2-4-7-16)18(14-25)23(30)28-24/h2-9,15,20H,10-13H2,1H3,(H2,27,28,29,30) |
| InChIKey | HEKFKRINNGMFKM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|