C15H17BrN4O3S — CID 168627432
ethyl 3-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]propanoate (PubChem CID 168627432) has the molecular formula C15H17BrN4O3S and a molecular weight of 413.30 g/mol. Its IUPAC name is ethyl 3-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]propanoate.
| Compound Name | ethyl 3-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]propanoate |
|---|---|
| PubChem CID | 168627432 |
| Molecular Formula | C15H17BrN4O3S |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | ethyl 3-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]propanoate |
| SMILES | CCOC(=O)CCOc1ccc(Br)cc1C=NNc1nc(N)cs1 |
| InChI | InChI=1S/C15H17BrN4O3S/c1-2-22-14(21)5-6-23-12-4-3-11(16)7-10(12)8-18-20-15-19-13(17)9-24-15/h3-4,7-9H,2,5-6,17H2,1H3,(H,19,20) |
| InChIKey | ZTFORKBALALEIS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|