C15H17BrN4O4S — CID 168627654
methyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate (PubChem CID 168627654) has the molecular formula C15H17BrN4O4S and a molecular weight of 429.30 g/mol. Its IUPAC name is methyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168627654 |
| Molecular Formula | C15H17BrN4O4S |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | methyl 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=NNc2nc(N)cs2)c(Br)cc1OCC(=O)OC |
| InChI | InChI=1S/C15H17BrN4O4S/c1-3-23-11-4-9(6-18-20-15-19-13(17)8-25-15)10(16)5-12(11)24-7-14(21)22-2/h4-6,8H,3,7,17H2,1-2H3,(H,19,20) |
| InChIKey | BBJNZJFLJMWEFD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|