C18H22BrN3O4S — CID 168618942
propan-2-yl 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 168618942) has the molecular formula C18H22BrN3O4S and a molecular weight of 456.36 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 168618942 |
| Molecular Formula | C18H22BrN3O4S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | propan-2-yl 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=NNc2nc(C)cs2)c(Br)cc1OCC(=O)OC(C)C |
| InChI | InChI=1S/C18H22BrN3O4S/c1-5-24-15-6-13(8-20-22-18-21-12(4)10-27-18)14(19)7-16(15)25-9-17(23)26-11(2)3/h6-8,10-11H,5,9H2,1-4H3,(H,21,22) |
| InChIKey | IYFAHKJIWDZYKC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|