C20H18BrN3O4S — CID 168578325
methyl 2-[5-bromo-2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 168578325) has the molecular formula C20H18BrN3O4S and a molecular weight of 476.35 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 168578325 |
| Molecular Formula | C20H18BrN3O4S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | methyl 2-[5-bromo-2-methoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(C=NNc2nc(-c3ccccc3)cs2)cc1OC |
| InChI | InChI=1S/C20H18BrN3O4S/c1-26-17-8-14(15(21)9-18(17)28-11-19(25)27-2)10-22-24-20-23-16(12-29-20)13-6-4-3-5-7-13/h3-10,12H,11H2,1-2H3,(H,23,24) |
| InChIKey | XNBKDTOXBZKFSL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|