C18H16BrN3O3S — CID 168577493
4-bromo-2,3-dimethoxy-6-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 168577493) has the molecular formula C18H16BrN3O3S and a molecular weight of 434.32 g/mol. Its IUPAC name is 4-bromo-2,3-dimethoxy-6-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2,3-dimethoxy-6-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 168577493 |
| Molecular Formula | C18H16BrN3O3S |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 4-bromo-2,3-dimethoxy-6-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1c(Br)cc(C=NNc2nc(-c3ccccc3)cs2)c(O)c1OC |
| InChI | InChI=1S/C18H16BrN3O3S/c1-24-16-13(19)8-12(15(23)17(16)25-2)9-20-22-18-21-14(10-26-18)11-6-4-3-5-7-11/h3-10,23H,1-2H3,(H,21,22) |
| InChIKey | FTBGTGLGOGSJNF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|