C16H10Br3N3OS — CID 168577785
2,4,6-tribromo-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 168577785) has the molecular formula C16H10Br3N3OS and a molecular weight of 532.06 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4,6-tribromo-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 168577785 |
| Molecular Formula | C16H10Br3N3OS |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 528.81 |
| IUPAC Name | 2,4,6-tribromo-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)c(C=NNc2nc(-c3ccccc3)cs2)c1Br |
| InChI | InChI=1S/C16H10Br3N3OS/c17-11-6-12(18)15(23)14(19)10(11)7-20-22-16-21-13(8-24-16)9-4-2-1-3-5-9/h1-8,23H,(H,21,22) |
| InChIKey | HBWJSDGCYRLRAJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|