C18H16ClN3OS — CID 168576736
4-chloro-3,6-dimethyl-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 168576736) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is 4-chloro-3,6-dimethyl-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-chloro-3,6-dimethyl-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 168576736 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-chloro-3,6-dimethyl-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1cc(Cl)c(C)c(C=NNc2nc(-c3ccccc3)cs2)c1O |
| InChI | InChI=1S/C18H16ClN3OS/c1-11-8-15(19)12(2)14(17(11)23)9-20-22-18-21-16(10-24-18)13-6-4-3-5-7-13/h3-10,23H,1-2H3,(H,21,22) |
| InChIKey | USORLMOCFLLCNK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|