C16H11ClFN3S — CID 168577116
N-[(3-chloro-4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577116) has the molecular formula C16H11ClFN3S and a molecular weight of 331.80 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577116 |
| Molecular Formula | C16H11ClFN3S |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1Cl |
| InChI | InChI=1S/C16H11ClFN3S/c17-13-8-11(6-7-14(13)18)9-19-21-16-20-15(10-22-16)12-4-2-1-3-5-12/h1-10H,(H,20,21) |
| InChIKey | DQSCMPMNNZLENH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|