C17H14FN3OS — CID 168577581
[2-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanol (PubChem CID 168577581) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanol.
| Compound Name | [2-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 168577581 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [2-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methanol |
| SMILES | OCc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1F |
| InChI | InChI=1S/C17H14FN3OS/c18-15-8-12(6-7-14(15)10-22)9-19-21-17-20-16(11-23-17)13-4-2-1-3-5-13/h1-9,11,22H,10H2,(H,20,21) |
| InChIKey | CDPBPJDSIUOOMJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|