C18H12F5N3OS — CID 168578224
N-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168578224) has the molecular formula C18H12F5N3OS and a molecular weight of 413.37 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168578224 |
| Molecular Formula | C18H12F5N3OS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(C=NNc2nc(-c3ccccc3)cs2)cc(F)c1OCC(F)(F)F |
| InChI | InChI=1S/C18H12F5N3OS/c19-13-6-11(7-14(20)16(13)27-10-18(21,22)23)8-24-26-17-25-15(9-28-17)12-4-2-1-3-5-12/h1-9H,10H2,(H,25,26) |
| InChIKey | HHITWPXUVQPWHT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|