C18H14F3N3OS — CID 168577559
4-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168577559) has the molecular formula C18H14F3N3OS and a molecular weight of 377.39 g/mol. Its IUPAC name is 4-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577559 |
| Molecular Formula | C18H14F3N3OS |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-phenyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)COc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C18H14F3N3OS/c19-18(20,21)12-25-15-8-6-13(7-9-15)10-22-24-17-23-16(11-26-17)14-4-2-1-3-5-14/h1-11H,12H2,(H,23,24) |
| InChIKey | DIEPOANXQHIYJX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|