C19H15N3O2S — CID 168579198
[5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-1-benzofuran-2-yl]methanol (PubChem CID 168579198) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is [5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-1-benzofuran-2-yl]methanol.
| Compound Name | [5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-1-benzofuran-2-yl]methanol |
|---|---|
| PubChem CID | 168579198 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-1-benzofuran-2-yl]methanol |
| SMILES | OCc1cc2cc(C=NNc3nc(-c4ccccc4)cs3)ccc2o1 |
| InChI | InChI=1S/C19H15N3O2S/c23-11-16-9-15-8-13(6-7-18(15)24-16)10-20-22-19-21-17(12-25-19)14-4-2-1-3-5-14/h1-10,12,23H,11H2,(H,21,22) |
| InChIKey | KLYCZYJQWDIZFT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|